C17H25BrN2O7 — CID 88725861
5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(ethoxymethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 88725861) has the molecular formula C17H25BrN2O7 and a molecular weight of 449.30 g/mol. Its IUPAC name is 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(ethoxymethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(ethoxymethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88725861 |
| Molecular Formula | C17H25BrN2O7 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-(ethoxymethoxy)-5-(ethoxymethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOCOC[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1OCOCC |
| InChI | InChI=1S/C17H25BrN2O7/c1-3-23-10-25-9-14-13(26-11-24-4-2)7-15(27-14)20-8-12(5-6-18)16(21)19-17(20)22/h5-6,8,13-15H,3-4,7,9-11H2,1-2H3,(H,19,21,22)/b6-5+/t13-,14+,15+/m0/s1 |
| InChIKey | PNMZCUGXKIQFKZ-VREHXWONSA-N |
| XLogP | 1.58 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|