C16H21BrN2O7 — CID 173431508
[(2R,3S,5R)-5-[5-(2-bromoethenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl butyl carbonate (PubChem CID 173431508) has the molecular formula C16H21BrN2O7 and a molecular weight of 433.26 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-(2-bromoethenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl butyl carbonate.
| Compound Name | [(2R,3S,5R)-5-[5-(2-bromoethenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl butyl carbonate |
|---|---|
| PubChem CID | 173431508 |
| Molecular Formula | C16H21BrN2O7 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [(2R,3S,5R)-5-[5-(2-bromoethenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl butyl carbonate |
| SMILES | CCCCOC(=O)OC[C@H]1O[C@@H](n2cc(C=CBr)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C16H21BrN2O7/c1-2-3-6-24-16(23)25-9-12-11(20)7-13(26-12)19-8-10(4-5-17)14(21)18-15(19)22/h4-5,8,11-13,20H,2-3,6-7,9H2,1H3,(H,18,21,22)/t11-,12+,13+/m0/s1 |
| InChIKey | BWHDJAXPKNTWEC-YNEHKIRRSA-N |
| XLogP | 1.50 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|