C14H16BrClN2O6 — CID 87478263
[(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxolan-2-yl]methyl ethyl carbonate (PubChem CID 87478263) has the molecular formula C14H16BrClN2O6 and a molecular weight of 423.65 g/mol. Its IUPAC name is [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxolan-2-yl]methyl ethyl carbonate.
| Compound Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxolan-2-yl]methyl ethyl carbonate |
|---|---|
| PubChem CID | 87478263 |
| Molecular Formula | C14H16BrClN2O6 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-chlorooxolan-2-yl]methyl ethyl carbonate |
| SMILES | CCOC(=O)OC[C@@H]1O[C@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)CC1Cl |
| InChI | InChI=1S/C14H16BrClN2O6/c1-2-22-14(21)23-7-10-9(16)5-11(24-10)18-6-8(3-4-15)12(19)17-13(18)20/h3-4,6,9-11H,2,5,7H2,1H3,(H,17,19,20)/b4-3+/t9?,10-,11-/m0/s1 |
| InChIKey | RXGLJQIEWJHROS-WETGOSLTSA-N |
| XLogP | 1.97 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|