C15H20BrClN2O6 — CID 88726970
5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-5-[(2-chloro-1-ethoxyethoxy)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 88726970) has the molecular formula C15H20BrClN2O6 and a molecular weight of 439.69 g/mol. Its IUPAC name is 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-5-[(2-chloro-1-ethoxyethoxy)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-5-[(2-chloro-1-ethoxyethoxy)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88726970 |
| Molecular Formula | C15H20BrClN2O6 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-5-[(2-chloro-1-ethoxyethoxy)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOC(CCl)OC[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C15H20BrClN2O6/c1-2-23-13(6-17)24-8-11-10(20)5-12(25-11)19-7-9(3-4-16)14(21)18-15(19)22/h3-4,7,10-13,20H,2,5-6,8H2,1H3,(H,18,21,22)/b4-3+/t10-,11+,12+,13?/m0/s1 |
| InChIKey | DFXHSOAEWKHOPN-UPMHXXEDSA-N |
| XLogP | 1.17 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|