C12H14BrClN2O6S — CID 87478437
[(2R,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-(chloromethyl)oxolan-3-yl] methanesulfonate (PubChem CID 87478437) has the molecular formula C12H14BrClN2O6S and a molecular weight of 429.68 g/mol. Its IUPAC name is [(2R,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-(chloromethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-(chloromethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87478437 |
| Molecular Formula | C12H14BrClN2O6S |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | [(2R,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-(chloromethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)O[C@H]1CCl |
| InChI | InChI=1S/C12H14BrClN2O6S/c1-23(19,20)22-8-4-10(21-9(8)5-14)16-6-7(2-3-13)11(17)15-12(16)18/h2-3,6,8-10H,4-5H2,1H3,(H,15,17,18)/b3-2+/t8?,9-,10-/m0/s1 |
| InChIKey | XRQXLCAMASGKMZ-UHKYEMIKSA-N |
| XLogP | 0.77 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|