C11H12ClF3N2O6S — CID 54153321
[(2S,3S,5R)-2-(chloromethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 54153321) has the molecular formula C11H12ClF3N2O6S and a molecular weight of 392.74 g/mol. Its IUPAC name is [(2S,3S,5R)-2-(chloromethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,3S,5R)-2-(chloromethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54153321 |
| Molecular Formula | C11H12ClF3N2O6S |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | [(2S,3S,5R)-2-(chloromethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | Cc1cn([C@H]2C[C@H](OS(=O)(=O)C(F)(F)F)[C@@H](CCl)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H12ClF3N2O6S/c1-5-4-17(10(19)16-9(5)18)8-2-6(7(3-12)22-8)23-24(20,21)11(13,14)15/h4,6-8H,2-3H2,1H3,(H,16,18,19)/t6-,7+,8+/m0/s1 |
| InChIKey | OJHDRSYQWIKUSD-XLPZGREQSA-N |
| XLogP | 0.61 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|