C19H21BrN2O7S — CID 87477038
[(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87477038) has the molecular formula C19H21BrN2O7S and a molecular weight of 501.36 g/mol. Its IUPAC name is [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87477038 |
| Molecular Formula | C19H21BrN2O7S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | [(2S,5S)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COC1C[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)O[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21BrN2O7S/c1-12-3-5-14(6-4-12)30(25,26)28-11-16-15(27-2)9-17(29-16)22-10-13(7-8-20)18(23)21-19(22)24/h3-8,10,15-17H,9,11H2,1-2H3,(H,21,23,24)/b8-7+/t15?,16-,17-/m0/s1 |
| InChIKey | YBSXYHUKDPABLF-XOVRKUIWSA-N |
| XLogP | 1.92 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|