C22H40N2O4Si — CID 59760587
3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 59760587) has the molecular formula C22H40N2O4Si and a molecular weight of 424.66 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59760587 |
| Molecular Formula | C22H40N2O4Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)n(CCCCO[Si](C)(C)C(C)(C)C)c2=O)C[C@@H]1C |
| InChI | InChI=1S/C22H40N2O4Si/c1-9-18-16(2)14-19(28-18)24-15-17(3)20(25)23(21(24)26)12-10-11-13-27-29(7,8)22(4,5)6/h15-16,18-19H,9-14H2,1-8H3/t16-,18+,19+/m0/s1 |
| InChIKey | VBJDCXLZALQIBU-QXAKKESOSA-N |
| XLogP | 4.45 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|