C13H21BN2O4 — CID 162268214
[3-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-methylborinic acid (PubChem CID 162268214) has the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. Its IUPAC name is [3-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-methylborinic acid.
| Compound Name | [3-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 162268214 |
| Molecular Formula | C13H21BN2O4 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [3-[(2R,4S,5R)-5-ethyl-4-methyloxolan-2-yl]-5-methyl-2,6-dioxopyrimidin-1-yl]-methylborinic acid |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)n(B(C)O)c2=O)C[C@@H]1C |
| InChI | InChI=1S/C13H21BN2O4/c1-5-10-8(2)6-11(20-10)15-7-9(3)12(17)16(13(15)18)14(4)19/h7-8,10-11,19H,5-6H2,1-4H3/t8-,10+,11+/m0/s1 |
| InChIKey | GVBPACYWQLLZKD-JMJZKYOTSA-N |
| XLogP | 0.61 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|