C21H39ClN2O4 — CID 158590452
(2S,3R,5S)-5-chloro-2-ethyl-3-methyloxolane;1-[(2S,4R,5S)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione;methane (PubChem CID 158590452) has the molecular formula C21H39ClN2O4 and a molecular weight of 419.01 g/mol. Its IUPAC name is (2S,3R,5S)-5-chloro-2-ethyl-3-methyloxolane;1-[(2S,4R,5S)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione;methane.
| Compound Name | (2S,3R,5S)-5-chloro-2-ethyl-3-methyloxolane;1-[(2S,4R,5S)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione;methane |
|---|---|
| PubChem CID | 158590452 |
| Molecular Formula | C21H39ClN2O4 |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2S,3R,5S)-5-chloro-2-ethyl-3-methyloxolane;1-[(2S,4R,5S)-5-ethyl-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione;methane |
| SMILES | C.C.CC[C@@H]1O[C@@H](Cl)C[C@H]1C.CC[C@@H]1O[C@H](n2cc(C)c(=O)[nH]c2=O)C[C@H]1C |
| InChI | InChI=1S/C12H18N2O3.C7H13ClO.2CH4/c1-4-9-7(2)5-10(17-9)14-6-8(3)11(15)13-12(14)16;1-3-6-5(2)4-7(8)9-6;;/h6-7,9-10H,4-5H2,1-3H3,(H,13,15,16);5-7H,3-4H2,1-2H3;2*1H4/t7-,9+,10+;5-,6+,7-;;/m11../s1 |
| InChIKey | HUJOFUMAEQYQOO-WCSOXLOTSA-N |
| XLogP | 4.84 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|