C20H34N2O6 — CID 160597134
1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione;(2R,3R,5S)-2-ethyl-5-propyloxolan-3-ol (PubChem CID 160597134) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione;(2R,3R,5S)-2-ethyl-5-propyloxolan-3-ol.
| Compound Name | 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione;(2R,3R,5S)-2-ethyl-5-propyloxolan-3-ol |
|---|---|
| PubChem CID | 160597134 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione;(2R,3R,5S)-2-ethyl-5-propyloxolan-3-ol |
| SMILES | CCC[C@H]1C[C@@H](O)[C@@H](CC)O1.CC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@H]1O |
| InChI | InChI=1S/C11H16N2O4.C9H18O2/c1-3-8-7(14)4-9(17-8)13-5-6(2)10(15)12-11(13)16;1-3-5-7-6-8(10)9(4-2)11-7/h5,7-9,14H,3-4H2,1-2H3,(H,12,15,16);7-10H,3-6H2,1-2H3/t7-,8-,9-;7-,8+,9+/m10/s1 |
| InChIKey | RDTXZYMEHNPQED-SSNHRVKBSA-N |
| XLogP | 1.62 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |