C25H46N2O5Si2 — CID 10791833
1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enyloxolan-2-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione (PubChem CID 10791833) has the molecular formula C25H46N2O5Si2 and a molecular weight of 510.82 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enyloxolan-2-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enyloxolan-2-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10791833 |
| Molecular Formula | C25H46N2O5Si2 |
| Molecular Weight | 510.82 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enyloxolan-2-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
| SMILES | C=CC[C@H]1C[C@H](n2cc(C)c(=O)n(COCC[Si](C)(C)C)c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46N2O5Si2/c1-11-12-20-15-22(32-21(20)17-31-34(9,10)25(3,4)5)26-16-19(2)23(28)27(24(26)29)18-30-13-14-33(6,7)8/h11,16,20-22H,1,12-15,17-18H2,2-10H3/t20-,21+,22+/m0/s1 |
| InChIKey | ZGBRHQXXGGLRRS-BHDDXSALSA-N |
| XLogP | 5.13 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|