C45H54N2O7SSi — CID 11556856
1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-3-(2-phenylsulfanylethyl)pyrimidine-2,4-dione (PubChem CID 11556856) has the molecular formula C45H54N2O7SSi and a molecular weight of 795.09 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-3-(2-phenylsulfanylethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-3-(2-phenylsulfanylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11556856 |
| Molecular Formula | C45H54N2O7SSi |
| Molecular Weight | 795.09 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methyl-3-(2-phenylsulfanylethyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H]2C[C@H](n3cc(C)c(=O)n(CCSc4ccccc4)c3=O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H54N2O7SSi/c1-32-30-47(43(49)46(42(32)48)27-28-55-38-17-13-10-14-18-38)41-29-39(40(53-41)31-52-56(7,8)44(2,3)4)54-45(33-15-11-9-12-16-33,34-19-23-36(50-5)24-20-34)35-21-25-37(51-6)26-22-35/h9-26,30,39-41H,27-29,31H2,1-8H3/t39-,40+,41+/m0/s1 |
| InChIKey | DDGBZSKZUVYULY-NJZAESGASA-N |
| XLogP | 8.81 |
| TPSA | 90.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.09 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|