C23H32N2O6Si — CID 132576591
1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3,4-dioxocyclohexa-1,5-dien-1-yl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 132576591) has the molecular formula C23H32N2O6Si and a molecular weight of 460.60 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3,4-dioxocyclohexa-1,5-dien-1-yl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3,4-dioxocyclohexa-1,5-dien-1-yl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132576591 |
| Molecular Formula | C23H32N2O6Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3,4-dioxocyclohexa-1,5-dien-1-yl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](CC3=CC(=O)C(=O)C=C3)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H32N2O6Si/c1-14-12-25(22(29)24-21(14)28)20-11-16(9-15-7-8-17(26)18(27)10-15)19(31-20)13-30-32(5,6)23(2,3)4/h7-8,10,12,16,19-20H,9,11,13H2,1-6H3,(H,24,28,29)/t16-,19+,20+/m0/s1 |
| InChIKey | GQOHBKJRQFTRDU-PWIZWCRZSA-N |
| XLogP | 2.80 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|