C15H25AcIN2O5Si — CID 59082571
actinium;1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 59082571) has the molecular formula C15H25AcIN2O5Si and a molecular weight of 695.36 g/mol. Its IUPAC name is actinium;1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | actinium;1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59082571 |
| Molecular Formula | C15H25AcIN2O5Si |
| Molecular Weight | 695.36 g/mol |
| Exact Mass | 695.09 |
| IUPAC Name | actinium;1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(I)c(=O)[nH]c2=O)C[C@H]1O.[Ac] |
| InChI | InChI=1S/C15H25IN2O5Si.Ac/c1-15(2,3)24(4,5)22-8-11-10(19)6-12(23-11)18-7-9(16)13(20)17-14(18)21;/h7,10-12,19H,6,8H2,1-5H3,(H,17,20,21);/t10-,11-,12-;/m1./s1 |
| InChIKey | JQNXKJDQGBLRCW-AUYLJXNTSA-N |
| XLogP | 1.81 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|