C9H11IN2O5 — CID 118403474
1-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 118403474) has the molecular formula C9H11IN2O5 and a molecular weight of 355.11 g/mol. Its IUPAC name is 1-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118403474 |
| Molecular Formula | C9H11IN2O5 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 1-[5-(deuteriooxymethyl)-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | [2H]OCC1OC(n2cc(I)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C9H11IN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/i13D |
| InChIKey | XQFRJNBWHJMXHO-YSOHJTORSA-N |
| XLogP | -1.22 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|