C10H13IN2O5 — CID 70996457
1-[(2R,5R)-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 70996457) has the molecular formula C10H13IN2O5 and a molecular weight of 368.13 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70996457 |
| Molecular Formula | C10H13IN2O5 |
| Molecular Weight | 368.13 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 1-[(2R,5R)-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | COC1C[C@H](n2cc(I)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H13IN2O5/c1-17-6-2-8(18-7(6)4-14)13-3-5(11)9(15)12-10(13)16/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6?,7-,8-/m1/s1 |
| InChIKey | WJTXONGQIXWPAG-SPDVFEMOSA-N |
| XLogP | -0.56 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.13 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|