C11H15IN2O5 — CID 70875165
5-iodo-1-[(2R,4S,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70875165) has the molecular formula C11H15IN2O5 and a molecular weight of 382.15 g/mol. Its IUPAC name is 5-iodo-1-[(2R,4S,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-[(2R,4S,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70875165 |
| Molecular Formula | C11H15IN2O5 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-iodo-1-[(2R,4S,5R)-4-methoxy-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC[C@H]1O[C@@H](n2cc(I)c(=O)[nH]c2=O)C[C@@H]1OC |
| InChI | InChI=1S/C11H15IN2O5/c1-17-5-8-7(18-2)3-9(19-8)14-4-6(12)10(15)13-11(14)16/h4,7-9H,3,5H2,1-2H3,(H,13,15,16)/t7-,8+,9+/m0/s1 |
| InChIKey | DFRRDUIVXGTYOH-DJLDLDEBSA-N |
| XLogP | 0.09 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|