C11H12FIN2O5 — CID 18648376
[(2R,3S,5R)-3-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 18648376) has the molecular formula C11H12FIN2O5 and a molecular weight of 398.13 g/mol. Its IUPAC name is [(2R,3S,5R)-3-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 18648376 |
| Molecular Formula | C11H12FIN2O5 |
| Molecular Weight | 398.13 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | [(2R,3S,5R)-3-fluoro-5-(5-iodo-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(I)c(=O)[nH]c2=O)C[C@@H]1F |
| InChI | InChI=1S/C11H12FIN2O5/c1-5(16)19-4-8-6(12)2-9(20-8)15-3-7(13)10(17)14-11(15)18/h3,6,8-9H,2,4H2,1H3,(H,14,17,18)/t6-,8+,9+/m0/s1 |
| InChIKey | FRTCAISSCLNCPU-NBEYISGCSA-N |
| XLogP | 0.33 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|