C12H14BrFN2O5 — CID 15614057
[(2R,3S,5R)-5-[5-(bromomethyl)-2,4-dioxopyrimidin-1-yl]-3-fluorooxolan-2-yl]methyl acetate (PubChem CID 15614057) has the molecular formula C12H14BrFN2O5 and a molecular weight of 365.16 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-(bromomethyl)-2,4-dioxopyrimidin-1-yl]-3-fluorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-5-[5-(bromomethyl)-2,4-dioxopyrimidin-1-yl]-3-fluorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15614057 |
| Molecular Formula | C12H14BrFN2O5 |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | [(2R,3S,5R)-5-[5-(bromomethyl)-2,4-dioxopyrimidin-1-yl]-3-fluorooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(CBr)c(=O)[nH]c2=O)C[C@@H]1F |
| InChI | InChI=1S/C12H14BrFN2O5/c1-6(17)20-5-9-8(14)2-10(21-9)16-4-7(3-13)11(18)15-12(16)19/h4,8-10H,2-3,5H2,1H3,(H,15,18,19)/t8-,9+,10+/m0/s1 |
| InChIKey | OXZKKOMFQJSNPC-IVZWLZJFSA-N |
| XLogP | 0.62 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|