C11H13FN4O5 — CID 70791160
[(2R,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-iminocarbamate (PubChem CID 70791160) has the molecular formula C11H13FN4O5 and a molecular weight of 300.25 g/mol. Its IUPAC name is [(2R,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-iminocarbamate.
| Compound Name | [(2R,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-iminocarbamate |
|---|---|
| PubChem CID | 70791160 |
| Molecular Formula | C11H13FN4O5 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [(2R,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-iminocarbamate |
| SMILES | [H]/N=N/C(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1F |
| InChI | InChI=1S/C11H13FN4O5/c1-5-3-16(10(18)14-9(5)17)8-2-6(12)7(21-8)4-20-11(19)15-13/h3,6-8,13H,2,4H2,1H3,(H,14,17,18)/b15-13+/t6?,7-,8-/m1/s1 |
| InChIKey | UVACXGOUFAFWBV-YODNMFNISA-N |
| XLogP | 0.64 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|