C9H10I2N2O4 — CID 67785008
1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 67785008) has the molecular formula C9H10I2N2O4 and a molecular weight of 464.00 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67785008 |
| Molecular Formula | C9H10I2N2O4 |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.87 |
| IUPAC Name | 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CI)O2)cc1I |
| InChI | InChI=1S/C9H10I2N2O4/c10-2-6-5(14)1-7(17-6)13-3-4(11)8(15)12-9(13)16/h3,5-7,14H,1-2H2,(H,12,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | AHTZKLABCDNRMG-RRKCRQDMSA-N |
| XLogP | 0.22 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|