C12H17IN2O5 — CID 139373191
[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] hypoiodite (PubChem CID 139373191) has the molecular formula C12H17IN2O5 and a molecular weight of 396.18 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] hypoiodite.
| Compound Name | [(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] hypoiodite |
|---|---|
| PubChem CID | 139373191 |
| Molecular Formula | C12H17IN2O5 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] hypoiodite |
| SMILES | CCc1cn([C@H]2C[C@H](OI)[C@@H](COC)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17IN2O5/c1-3-7-5-15(12(17)14-11(7)16)10-4-8(20-13)9(19-10)6-18-2/h5,8-10H,3-4,6H2,1-2H3,(H,14,16,17)/t8-,9+,10+/m0/s1 |
| InChIKey | XORIAMJHPUNUJC-IVZWLZJFSA-N |
| XLogP | 0.77 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|