C15H26IN3O4Si — CID 176808452
4-amino-1-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one (PubChem CID 176808452) has the molecular formula C15H26IN3O4Si and a molecular weight of 467.38 g/mol. Its IUPAC name is 4-amino-1-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one |
|---|---|
| PubChem CID | 176808452 |
| Molecular Formula | C15H26IN3O4Si |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 4-amino-1-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-iodopyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](n2cc(I)c(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C15H26IN3O4Si/c1-15(2,3)24(4,5)22-8-11-10(20)6-12(23-11)19-7-9(16)13(17)18-14(19)21/h7,10-12,20H,6,8H2,1-5H3,(H2,17,18,21)/t10-,11-,12-/m0/s1 |
| InChIKey | GKUIXIRTAVPIGD-SRVKXCTJSA-N |
| XLogP | 2.10 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|