C9H11IN4O6 — CID 10916312
[(2R,3S,5R)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] nitrate (PubChem CID 10916312) has the molecular formula C9H11IN4O6 and a molecular weight of 398.11 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] nitrate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] nitrate |
|---|---|
| PubChem CID | 10916312 |
| Molecular Formula | C9H11IN4O6 |
| Molecular Weight | 398.11 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] nitrate |
| SMILES | Nc1nc(=O)n([C@H]2C[C@H](O[N+](=O)[O-])[C@@H](CO)O2)cc1I |
| InChI | InChI=1S/C9H11IN4O6/c10-4-2-13(9(16)12-8(4)11)7-1-5(20-14(17)18)6(3-15)19-7/h2,5-7,15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
| InChIKey | HRDXGNISVLWZCO-RRKCRQDMSA-N |
| XLogP | -0.71 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.11 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|