C22H26N6O8 — CID 139061383
4-amino-5-ethynyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 139061383) has the molecular formula C22H26N6O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is 4-amino-5-ethynyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-ethynyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 139061383 |
| Molecular Formula | C22H26N6O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 4-amino-5-ethynyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)nc1N.C#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)nc1N |
| InChI | InChI=1S/2C11H13N3O4/c2*1-2-6-4-14(11(17)13-10(6)12)9-3-7(16)8(5-15)18-9/h2*1,4,7-9,15-16H,3,5H2,(H2,12,13,17)/t2*7-,8+,9+/m00/s1 |
| InChIKey | JYAOYJNIWCXJDM-PZLMVSHZSA-N |
| XLogP | -3.11 |
| TPSA | 221.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|