C11H16ClN3O5 — CID 74433123
4-amino-5-(2-chloro-1-hydroxyethyl)-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 74433123) has the molecular formula C11H16ClN3O5 and a molecular weight of 305.72 g/mol. Its IUPAC name is 4-amino-5-(2-chloro-1-hydroxyethyl)-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-(2-chloro-1-hydroxyethyl)-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 74433123 |
| Molecular Formula | C11H16ClN3O5 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-amino-5-(2-chloro-1-hydroxyethyl)-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n(C2CC(O)C(CO)O2)cc1C(O)CCl |
| InChI | InChI=1S/C11H16ClN3O5/c12-2-7(18)5-3-15(11(19)14-10(5)13)9-1-6(17)8(4-16)20-9/h3,6-9,16-18H,1-2,4H2,(H2,13,14,19) |
| InChIKey | NWVSPXRAKKUKAC-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|