C9H16O5S — CID 123740524
[2-(1,3-dioxolan-2-yl)cyclopentyl] methanesulfonate (PubChem CID 123740524) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)cyclopentyl] methanesulfonate.
| Compound Name | [2-(1,3-dioxolan-2-yl)cyclopentyl] methanesulfonate |
|---|---|
| PubChem CID | 123740524 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)cyclopentyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCCC1C1OCCO1 |
| InChI | InChI=1S/C9H16O5S/c1-15(10,11)14-8-4-2-3-7(8)9-12-5-6-13-9/h7-9H,2-6H2,1H3 |
| InChIKey | UIHODYBFAJBEPR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|