C10H18O2 — CID 159348554
2-[(1R,2R)-2-ethylcyclopentyl]-1,3-dioxolane (PubChem CID 159348554) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-[(1R,2R)-2-ethylcyclopentyl]-1,3-dioxolane.
| Compound Name | 2-[(1R,2R)-2-ethylcyclopentyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 159348554 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-[(1R,2R)-2-ethylcyclopentyl]-1,3-dioxolane |
| SMILES | CC[C@@H]1CCC[C@H]1C1OCCO1 |
| InChI | InChI=1S/C10H18O2/c1-2-8-4-3-5-9(8)10-11-6-7-12-10/h8-10H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | QVUHJDCWFOYGQB-RKDXNWHRSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |