C33H58CoN8O3S — CID 174523809
cobalt;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl methanesulfonate (PubChem CID 174523809) has the molecular formula C33H58CoN8O3S and a molecular weight of 705.88 g/mol. Its IUPAC name is cobalt;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl methanesulfonate.
| Compound Name | cobalt;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl methanesulfonate |
|---|---|
| PubChem CID | 174523809 |
| Molecular Formula | C33H58CoN8O3S |
| Molecular Weight | 705.88 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | cobalt;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41.[Co] |
| InChI | InChI=1S/C33H58N8O3S.Co/c1-45(42,43)44-24-16-8-15-23-25(24)33-40-31-22-14-7-6-13-21(22)29(38-31)36-27-18-10-3-2-9-17(18)26(34-27)35-28-19-11-4-5-12-20(19)30(37-28)39-32(23)41-33;/h17-41H,2-16H2,1H3; |
| InChIKey | VRCRTIVWAUJDRB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.88 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|