C65H110N16O — CID 174259267
bis(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)methanone (PubChem CID 174259267) has the molecular formula C65H110N16O and a molecular weight of 1131.71 g/mol. Its IUPAC name is bis(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)methanone.
| Compound Name | bis(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)methanone |
|---|---|
| PubChem CID | 174259267 |
| Molecular Formula | C65H110N16O |
| Molecular Weight | 1131.71 g/mol |
| Exact Mass | 1130.90 |
| IUPAC Name | bis(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)methanone |
| SMILES | O=C(C1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41)C1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C65H110N16O/c82-49(43-27-13-29-45-47(43)64-78-60-41-25-11-9-23-39(41)56(74-60)70-52-33-17-3-1-15-31(33)50(66-52)68-54-35-19-5-7-21-37(35)58(72-54)76-62(45)80-64)44-28-14-30-46-48(44)65-79-61-42-26-12-10-24-40(42)57(75-61)71-53-34-18-4-2-16-32(34)51(67-53)69-55-36-20-6-8-22-38(36)59(73-55)77-63(46)81-65/h31-48,50-81H,1-30H2 |
| InChIKey | MUKLLOGUGGIRGE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 209.55 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 17 |