About CID 173331089
CID 173331089 (PubChem CID 173331089) has the molecular formula C32H55AlN8O
and a molecular weight of 594.83 g/mol.
Molecular Properties
| Compound Name | CID 173331089 |
| PubChem CID | 173331089 |
| Molecular Formula | C32H55AlN8O |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | — |
| SMILES | [Al]OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C32H55N8O.Al/c41-23-15-7-14-22-24(23)32-39-30-21-13-6-5-12-20(21)28(37-30)35-26-17-9-2-1-8-16(17)25(33-26)34-27-18-10-3-4-11-19(18)29(36-27)38-31(22)40-32;/h16-40H,1-15H2;/q-1;+1 |
| InChIKey | QFKJBQKOEXHEOG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CID 173331089 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173331089?
The IUPAC name of CID 173331089 (CID 173331089) is not available.
What is the SMILES notation for CID 173331089?
The canonical SMILES for CID 173331089 is [Al]OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41.
What is the InChIKey of CID 173331089?
The InChIKey is QFKJBQKOEXHEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H55N8O.Al/c41-23-15-7-14-22-24(23)32-39-30-21-13-6-5-12-20(21)28(37-30)35-26-17-9-2-1-8-16(17)25(33-26)34-27-18-10-3-4-11-19(18)29(36-27)38-31(22)40-32;/h16-40H,1-15H2;/q-1;+1.
What are the key properties of CID 173331089?
CID 173331089 has a molecular weight of 594.83 g/mol, XLogP of 1.68, 1 rotatable bonds, 8 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173331089 is sourced from PubChem (CID 173331089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).