C32H55AlN8O — CID 173331089
CID 173331089 (PubChem CID 173331089) has the molecular formula C32H55AlN8O and a molecular weight of 594.83 g/mol.
| Compound Name | CID 173331089 |
|---|---|
| PubChem CID | 173331089 |
| Molecular Formula | C32H55AlN8O |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | — |
| SMILES | [Al]OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C32H55N8O.Al/c41-23-15-7-14-22-24(23)32-39-30-21-13-6-5-12-20(21)28(37-30)35-26-17-9-2-1-8-16(17)25(33-26)34-27-18-10-3-4-11-19(18)29(36-27)38-31(22)40-32;/h16-40H,1-15H2;/q-1;+1 |
| InChIKey | QFKJBQKOEXHEOG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |