C60H112N8O4 — CID 5246615
5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 5246615) has the molecular formula C60H112N8O4 and a molecular weight of 1009.61 g/mol. Its IUPAC name is 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 5246615 |
| Molecular Formula | C60H112N8O4 |
| Molecular Weight | 1009.61 g/mol |
| Exact Mass | 1008.88 |
| IUPAC Name | 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CC(C)C(OC1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(OC(C(C)C)C(C)C)CCCC63)C3C(OC(C(C)C)C(C)C)CCCC53)C3C(OC(C(C)C)C(C)C)CCCC43)C12)C(C)C |
| InChI | InChI=1S/C60H112N8O4/c1-29(2)49(30(3)4)69-41-25-17-21-37-45(41)57-61-53(37)66-58-47-39(23-19-27-43(47)71-51(33(9)10)34(11)12)55(63-58)68-60-48-40(24-20-28-44(48)72-52(35(13)14)36(15)16)56(64-60)67-59-46-38(54(62-59)65-57)22-18-26-42(46)70-50(31(5)6)32(7)8/h29-68H,17-28H2,1-16H3 |
| InChIKey | ZEWADCKPTRZGDA-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.61 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |