C41H74N8O7 — CID 91252131
2-[[23,32-bis(2-hydroxyethoxy)-14-propoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]oxy]ethanol (PubChem CID 91252131) has the molecular formula C41H74N8O7 and a molecular weight of 791.09 g/mol. Its IUPAC name is 2-[[23,32-bis(2-hydroxyethoxy)-14-propoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]oxy]ethanol.
| Compound Name | 2-[[23,32-bis(2-hydroxyethoxy)-14-propoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]oxy]ethanol |
|---|---|
| PubChem CID | 91252131 |
| Molecular Formula | C41H74N8O7 |
| Molecular Weight | 791.09 g/mol |
| Exact Mass | 790.57 |
| IUPAC Name | 2-[[23,32-bis(2-hydroxyethoxy)-14-propoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]oxy]ethanol |
| SMILES | CCCOC1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(OCCO)CCCC63)C3C(OCCO)CCCC53)C3C(OCCO)CCCC43)C12 |
| InChI | InChI=1S/C41H74N8O7/c1-2-18-53-26-11-3-7-22-30(26)38-42-34(22)44-39-32-24(9-5-13-28(32)55-20-16-51)36(46-39)48-41-33-25(10-6-14-29(33)56-21-17-52)37(49-41)47-40-31-23(35(43-38)45-40)8-4-12-27(31)54-19-15-50/h22-52H,2-21H2,1H3 |
| InChIKey | LVEVHLTWFJOSLZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 193.85 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.09 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |