C10H18O2 — CID 90023539
2-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy)ethanol (PubChem CID 90023539) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy)ethanol.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy)ethanol |
|---|---|
| PubChem CID | 90023539 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy)ethanol |
| SMILES | OCCOC1CCC2CCCC21 |
| InChI | InChI=1S/C10H18O2/c11-6-7-12-10-5-4-8-2-1-3-9(8)10/h8-11H,1-7H2 |
| InChIKey | ZTABTHYSWRANGY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |