About 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol
2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol (PubChem CID 155269084) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol.
Analyze 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol?
The IUPAC name of 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol (CID 155269084) is 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol.
What is the SMILES notation for 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol?
The canonical SMILES for 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol is OCCO[C@H]1CCC[C@H]1OCCO.
What is the InChIKey of 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol?
The InChIKey is XBHVALDFYMKJPO-DTORHVGOSA-N. The full InChI is InChI=1S/C9H18O4/c10-4-6-12-8-2-1-3-9(8)13-7-5-11/h8-11H,1-7H2/t8-,9+.
What are the key properties of 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol?
2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol has a molecular weight of 190.24 g/mol, XLogP of -0.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-(2-hydroxyethoxy)cyclopentyl]oxyethanol is sourced from PubChem (CID 155269084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).