C13H26O2 — CID 58242222
2-[(1S,2S)-2-(3-methylbutyl)cyclohexyl]oxyethanol (PubChem CID 58242222) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(3-methylbutyl)cyclohexyl]oxyethanol.
| Compound Name | 2-[(1S,2S)-2-(3-methylbutyl)cyclohexyl]oxyethanol |
|---|---|
| PubChem CID | 58242222 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-[(1S,2S)-2-(3-methylbutyl)cyclohexyl]oxyethanol |
| SMILES | CC(C)CC[C@@H]1CCCC[C@@H]1OCCO |
| InChI | InChI=1S/C13H26O2/c1-11(2)7-8-12-5-3-4-6-13(12)15-10-9-14/h11-14H,3-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | KFGCEQQRLFFREK-STQMWFEESA-N |
| XLogP | 2.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |