C12H22O2 — CID 12753759
2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yloxy)ethanol (PubChem CID 12753759) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yloxy)ethanol.
| Compound Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yloxy)ethanol |
|---|---|
| PubChem CID | 12753759 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yloxy)ethanol |
| SMILES | OCCOC1CCCC2CCCCC21 |
| InChI | InChI=1S/C12H22O2/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12/h10-13H,1-9H2 |
| InChIKey | NBJUEVWVAJZFLO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |