C14H30N2O4 — CID 155305830
2-[2-[(1R,2S)-2-[2-(2-hydroxyethylamino)ethoxy]cyclohexyl]oxyethylamino]ethanol (PubChem CID 155305830) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[2-[(1R,2S)-2-[2-(2-hydroxyethylamino)ethoxy]cyclohexyl]oxyethylamino]ethanol.
| Compound Name | 2-[2-[(1R,2S)-2-[2-(2-hydroxyethylamino)ethoxy]cyclohexyl]oxyethylamino]ethanol |
|---|---|
| PubChem CID | 155305830 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[2-[(1R,2S)-2-[2-(2-hydroxyethylamino)ethoxy]cyclohexyl]oxyethylamino]ethanol |
| SMILES | OCCNCCO[C@H]1CCCC[C@H]1OCCNCCO |
| InChI | InChI=1S/C14H30N2O4/c17-9-5-15-7-11-19-13-3-1-2-4-14(13)20-12-8-16-6-10-18/h13-18H,1-12H2/t13-,14+ |
| InChIKey | MKLCFFYENZHKNV-OKILXGFUSA-N |
| XLogP | -0.51 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|