C12H20O2 — CID 16756226
1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl butanoate (PubChem CID 16756226) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl butanoate.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl butanoate |
|---|---|
| PubChem CID | 16756226 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl butanoate |
| SMILES | CCCC(=O)OC1CCC2CCCC21 |
| InChI | InChI=1S/C12H20O2/c1-2-4-12(13)14-11-8-7-9-5-3-6-10(9)11/h9-11H,2-8H2,1H3 |
| InChIKey | XZPAEEXOWCRZQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |