C15H24O4 — CID 23256437
[(1S,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undecan-8-yl] butanoate (PubChem CID 23256437) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(1S,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undecan-8-yl] butanoate.
| Compound Name | [(1S,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undecan-8-yl] butanoate |
|---|---|
| PubChem CID | 23256437 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(1S,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undecan-8-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@@H]2CC[C@H]1[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H24O4/c1-4-5-12(16)17-11-8-9-6-7-10(11)14-13(9)18-15(2,3)19-14/h9-11,13-14H,4-8H2,1-3H3/t9-,10+,11-,13-,14+/m0/s1 |
| InChIKey | LMEYDAMPFRVMAQ-GGFUIZRSSA-N |
| XLogP | 2.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |