C10H16O2 — CID 12513637
(1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (PubChem CID 12513637) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 12513637 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
| SMILES | CC1(C)O[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2O1 |
| InChI | InChI=1S/C10H16O2/c1-10(2)11-8-6-3-4-7(5-6)9(8)12-10/h6-9H,3-5H2,1-2H3/t6-,7+,8+,9- |
| InChIKey | JGZIHBIYBQJDMR-OJOKCITNSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |