C10H14Br2O2 — CID 11131187
(1S,2R,6S,7R,8R,9R)-8,9-dibromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane (PubChem CID 11131187) has the molecular formula C10H14Br2O2 and a molecular weight of 326.03 g/mol. Its IUPAC name is (1S,2R,6S,7R,8R,9R)-8,9-dibromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6S,7R,8R,9R)-8,9-dibromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 11131187 |
| Molecular Formula | C10H14Br2O2 |
| Molecular Weight | 326.03 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | (1S,2R,6S,7R,8R,9R)-8,9-dibromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H]([C@@H](Br)[C@@H]3Br)[C@@H]2O1 |
| InChI | InChI=1S/C10H14Br2O2/c1-10(2)13-8-4-3-5(9(8)14-10)7(12)6(4)11/h4-9H,3H2,1-2H3/t4-,5+,6-,7-,8-,9+/m1/s1 |
| InChIKey | SKDBWLTZEFKTEU-IQBJDPKBSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.03 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|