C10H17BrO3 — CID 11777609
(3aR,4S,6R,6aS)-6-(2-bromoethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (PubChem CID 11777609) has the molecular formula C10H17BrO3 and a molecular weight of 265.15 g/mol. Its IUPAC name is (3aR,4S,6R,6aS)-6-(2-bromoethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4S,6R,6aS)-6-(2-bromoethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11777609 |
| Molecular Formula | C10H17BrO3 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (3aR,4S,6R,6aS)-6-(2-bromoethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](CCBr)C[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C10H17BrO3/c1-10(2)13-8-6(3-4-11)5-7(12)9(8)14-10/h6-9,12H,3-5H2,1-2H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | YEVVVSPJBKRXAO-XSPKLOCKSA-N |
| XLogP | 1.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|