C9H16O4S — CID 11368010
(3aR,4S,8R,8aS)-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol (PubChem CID 11368010) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (3aR,4S,8R,8aS)-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol.
| Compound Name | (3aR,4S,8R,8aS)-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
|---|---|
| PubChem CID | 11368010 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3aR,4S,8R,8aS)-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](O)CSC[C@@H]2O |
| InChI | InChI=1S/C9H16O4S/c1-9(2)12-7-5(10)3-14-4-6(11)8(7)13-9/h5-8,10-11H,3-4H2,1-2H3/t5-,6+,7-,8+ |
| InChIKey | AMTZCFFTUVSCSK-KVFPUHGPSA-N |
| XLogP | -0.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |