C5H10O4 — CID 101384233
(4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-diol (PubChem CID 101384233) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-diol.
| Compound Name | (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-diol |
|---|---|
| PubChem CID | 101384233 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-diol |
| SMILES | CC1(C)O[C@H](O)[C@@H](O)O1 |
| InChI | InChI=1S/C5H10O4/c1-5(2)8-3(6)4(7)9-5/h3-4,6-7H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | OARHGKBZPURGOL-IMJSIDKUSA-N |
| XLogP | -0.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |