C9H16O5 — CID 14487703
2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol (PubChem CID 14487703) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol.
| Compound Name | 2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
|---|---|
| PubChem CID | 14487703 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
| SMILES | CC1OC(O)C(O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C9H16O5/c1-4-6-7(5(10)8(11)12-4)14-9(2,3)13-6/h4-8,10-11H,1-3H3 |
| InChIKey | SUUCYSBBOBCNDI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |