C11H16Cl3NO5 — CID 130278971
[(3aS,6R,7R)-7-hydroxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] 2,2,2-trichloroethanimidate (PubChem CID 130278971) has the molecular formula C11H16Cl3NO5 and a molecular weight of 348.61 g/mol. Its IUPAC name is [(3aS,6R,7R)-7-hydroxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aS,6R,7R)-7-hydroxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 130278971 |
| Molecular Formula | C11H16Cl3NO5 |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | [(3aS,6R,7R)-7-hydroxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1OC(C)[C@@H]2OC(C)(C)OC2[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO5/c1-4-6-7(20-10(2,3)19-6)5(16)8(17-4)18-9(15)11(12,13)14/h4-8,15-16H,1-3H3/b15-9+/t4?,5-,6+,7?,8-/m1/s1 |
| InChIKey | VDUFNXYGKBNRLM-VVWAKRMTSA-N |
| XLogP | 1.98 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|