C17H30Cl3NO5Si — CID 24786930
[(3aR,4S,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 24786930) has the molecular formula C17H30Cl3NO5Si and a molecular weight of 462.87 g/mol. Its IUPAC name is [(3aR,4S,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,4S,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 24786930 |
| Molecular Formula | C17H30Cl3NO5Si |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [(3aR,4S,6S,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H30Cl3NO5Si/c1-9-10(26-27(7,8)15(2,3)4)11-12(25-16(5,6)24-11)13(22-9)23-14(21)17(18,19)20/h9-13,21H,1-8H3/b21-14+/t9-,10-,11+,12+,13-/m0/s1 |
| InChIKey | FUJMMLCSRPGCAO-GZGUAHHDSA-N |
| XLogP | 5.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|