C20H38Cl3NO3Si2 — CID 11016594
[(1R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate (PubChem CID 11016594) has the molecular formula C20H38Cl3NO3Si2 and a molecular weight of 503.06 g/mol. Its IUPAC name is [(1R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11016594 |
| Molecular Formula | C20H38Cl3NO3Si2 |
| Molecular Weight | 503.06 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [(1R,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H38Cl3NO3Si2/c1-18(2,3)28(7,8)26-15-12-11-14(25-17(24)20(21,22)23)13-16(15)27-29(9,10)19(4,5)6/h11-12,14-16,24H,13H2,1-10H3/b24-17+/t14-,15+,16-/m0/s1 |
| InChIKey | LOAXDRZZKIIHJF-JKFUWNCFSA-N |
| XLogP | 7.46 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.06 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|